C7H12FNO — CID 89115118
3-fluoro-4,5,6-trimethyl-2,3-dihydro-1,4-oxazine (PubChem CID 89115118) has the molecular formula C7H12FNO and a molecular weight of 145.18 g/mol. Its IUPAC name is 3-fluoro-4,5,6-trimethyl-2,3-dihydro-1,4-oxazine.
| Compound Name | 3-fluoro-4,5,6-trimethyl-2,3-dihydro-1,4-oxazine |
|---|---|
| PubChem CID | 89115118 |
| Molecular Formula | C7H12FNO |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 3-fluoro-4,5,6-trimethyl-2,3-dihydro-1,4-oxazine |
| SMILES | CC1=C(C)N(C)C(F)CO1 |
| InChI | InChI=1S/C7H12FNO/c1-5-6(2)10-4-7(8)9(5)3/h7H,4H2,1-3H3 |
| InChIKey | NTCHVLFGRWUNLR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|