C37H23F9O6S2 — CID 89116649
[6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(6-methylsulfonyloxynaphthalen-2-yl)phenyl]propan-2-yl]phenyl]naphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 89116649) has the molecular formula C37H23F9O6S2 and a molecular weight of 798.70 g/mol. Its IUPAC name is [6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(6-methylsulfonyloxynaphthalen-2-yl)phenyl]propan-2-yl]phenyl]naphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(6-methylsulfonyloxynaphthalen-2-yl)phenyl]propan-2-yl]phenyl]naphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89116649 |
| Molecular Formula | C37H23F9O6S2 |
| Molecular Weight | 798.70 g/mol |
| Exact Mass | 798.08 |
| IUPAC Name | [6-[4-[1,1,1,3,3,3-hexafluoro-2-[4-(6-methylsulfonyloxynaphthalen-2-yl)phenyl]propan-2-yl]phenyl]naphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2cc(-c3ccc(C(c4ccc(-c5ccc6cc(OS(=O)(=O)C(F)(F)F)ccc6c5)cc4)(C(F)(F)F)C(F)(F)F)cc3)ccc2c1 |
| InChI | InChI=1S/C37H23F9O6S2/c1-53(47,48)51-32-16-10-26-18-24(2-4-28(26)20-32)22-6-12-30(13-7-22)34(35(38,39)40,36(41,42)43)31-14-8-23(9-15-31)25-3-5-29-21-33(17-11-27(29)19-25)52-54(49,50)37(44,45)46/h2-21H,1H3 |
| InChIKey | VZACVOAVYVKDBT-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.70 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|