C17H28O3 — CID 89116696
(E)-4-acetylpentadec-6-ene-2,14-dione (PubChem CID 89116696) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (E)-4-acetylpentadec-6-ene-2,14-dione.
| Compound Name | (E)-4-acetylpentadec-6-ene-2,14-dione |
|---|---|
| PubChem CID | 89116696 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (E)-4-acetylpentadec-6-ene-2,14-dione |
| SMILES | CC(=O)CCCCCC/C=C/CC(CC(C)=O)C(C)=O |
| InChI | InChI=1S/C17H28O3/c1-14(18)11-9-7-5-4-6-8-10-12-17(16(3)20)13-15(2)19/h8,10,17H,4-7,9,11-13H2,1-3H3/b10-8+ |
| InChIKey | UCBVAIFBVCRRSS-CSKARUKUSA-N |
| XLogP | 4.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|