C17H17F3N2O3 — CID 8911786
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-ethyl-2,5-dimethylpyrrole-3-carboxylate (PubChem CID 8911786) has the molecular formula C17H17F3N2O3 and a molecular weight of 354.33 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-ethyl-2,5-dimethylpyrrole-3-carboxylate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-ethyl-2,5-dimethylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 8911786 |
| Molecular Formula | C17H17F3N2O3 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 1-ethyl-2,5-dimethylpyrrole-3-carboxylate |
| SMILES | CCn1c(C)cc(C(=O)OCC(=O)Nc2ccc(F)c(F)c2F)c1C |
| InChI | InChI=1S/C17H17F3N2O3/c1-4-22-9(2)7-11(10(22)3)17(24)25-8-14(23)21-13-6-5-12(18)15(19)16(13)20/h5-7H,4,8H2,1-3H3,(H,21,23) |
| InChIKey | SZNPMUKQBJCADR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|