C12H9N3OS — CID 89118347
2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophene-3-carbaldehyde (PubChem CID 89118347) has the molecular formula C12H9N3OS and a molecular weight of 243.29 g/mol. Its IUPAC name is 2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophene-3-carbaldehyde.
| Compound Name | 2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophene-3-carbaldehyde |
|---|---|
| PubChem CID | 89118347 |
| Molecular Formula | C12H9N3OS |
| Molecular Weight | 243.29 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophene-3-carbaldehyde |
| SMILES | O=Cc1ccsc1Nc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C12H9N3OS/c16-7-8-3-6-17-12(8)15-10-2-5-14-11-9(10)1-4-13-11/h1-7H,(H2,13,14,15) |
| InChIKey | TVVHMRXWZMWZSJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|