C22H23N5O2S — CID 130442873
[3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-2-yl] N-[2-[(4-methylphenyl)methylamino]ethyl]carbamate (PubChem CID 130442873) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is [3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-2-yl] N-[2-[(4-methylphenyl)methylamino]ethyl]carbamate.
| Compound Name | [3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-2-yl] N-[2-[(4-methylphenyl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 130442873 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | [3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-2-yl] N-[2-[(4-methylphenyl)methylamino]ethyl]carbamate |
| SMILES | Cc1ccc(CNCCNC(=O)Oc2sccc2Nc2ccnc3[nH]ccc23)cc1 |
| InChI | InChI=1S/C22H23N5O2S/c1-15-2-4-16(5-3-15)14-23-11-12-26-22(28)29-21-19(8-13-30-21)27-18-7-10-25-20-17(18)6-9-24-20/h2-10,13,23H,11-12,14H2,1H3,(H,26,28)(H2,24,25,27) |
| InChIKey | CJAFULLWUFGKFA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|