C21H19ClFN5O2S — CID 130442801
[3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-2-yl] N-[2-[(3-chloro-4-fluorophenyl)methylamino]ethyl]carbamate (PubChem CID 130442801) has the molecular formula C21H19ClFN5O2S and a molecular weight of 459.93 g/mol. Its IUPAC name is [3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-2-yl] N-[2-[(3-chloro-4-fluorophenyl)methylamino]ethyl]carbamate.
| Compound Name | [3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-2-yl] N-[2-[(3-chloro-4-fluorophenyl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 130442801 |
| Molecular Formula | C21H19ClFN5O2S |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | [3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophen-2-yl] N-[2-[(3-chloro-4-fluorophenyl)methylamino]ethyl]carbamate |
| SMILES | O=C(NCCNCc1ccc(F)c(Cl)c1)Oc1sccc1Nc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C21H19ClFN5O2S/c22-15-11-13(1-2-16(15)23)12-24-8-9-27-21(29)30-20-18(5-10-31-20)28-17-4-7-26-19-14(17)3-6-25-19/h1-7,10-11,24H,8-9,12H2,(H,27,29)(H2,25,26,28) |
| InChIKey | DNIQPGUTPKMDOI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 91.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|