C19H16N4OS — CID 130459068
N-benzyl-3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophene-2-carboxamide (PubChem CID 130459068) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is N-benzyl-3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophene-2-carboxamide.
| Compound Name | N-benzyl-3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 130459068 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-benzyl-3-(1H-pyrrolo[2,3-b]pyridin-4-ylamino)thiophene-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1sccc1Nc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C19H16N4OS/c24-19(22-12-13-4-2-1-3-5-13)17-16(8-11-25-17)23-15-7-10-21-18-14(15)6-9-20-18/h1-11H,12H2,(H,22,24)(H2,20,21,23) |
| InChIKey | OKWZZIKRIWHDEF-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |