C21H21N5OS — CID 158201886
N-(4-phenylbutyl)-3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxamide (PubChem CID 158201886) has the molecular formula C21H21N5OS and a molecular weight of 391.50 g/mol. Its IUPAC name is N-(4-phenylbutyl)-3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxamide.
| Compound Name | N-(4-phenylbutyl)-3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 158201886 |
| Molecular Formula | C21H21N5OS |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-(4-phenylbutyl)-3-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)thiophene-2-carboxamide |
| SMILES | O=C(NCCCCc1ccccc1)c1sccc1Nc1ncnc2[nH]ccc12 |
| InChI | InChI=1S/C21H21N5OS/c27-21(23-11-5-4-8-15-6-2-1-3-7-15)18-17(10-13-28-18)26-20-16-9-12-22-19(16)24-14-25-20/h1-3,6-7,9-10,12-14H,4-5,8,11H2,(H,23,27)(H2,22,24,25,26) |
| InChIKey | GBARBHZSRLDBRC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|