C19H22N6O3 — CID 175407919
N-[6-(hydroxyamino)-6-oxo-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)hexyl]benzamide (PubChem CID 175407919) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[6-(hydroxyamino)-6-oxo-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)hexyl]benzamide.
| Compound Name | N-[6-(hydroxyamino)-6-oxo-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)hexyl]benzamide |
|---|---|
| PubChem CID | 175407919 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-[6-(hydroxyamino)-6-oxo-4-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)hexyl]benzamide |
| SMILES | O=C(CC(CCCNC(=O)c1ccccc1)Nc1ncnc2[nH]ccc12)NO |
| InChI | InChI=1S/C19H22N6O3/c26-16(25-28)11-14(24-18-15-8-10-20-17(15)22-12-23-18)7-4-9-21-19(27)13-5-2-1-3-6-13/h1-3,5-6,8,10,12,14,28H,4,7,9,11H2,(H,21,27)(H,25,26)(H2,20,22,23,24) |
| InChIKey | OPYXMNBLQVEJCX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|