C24H21F6N3O — CID 89121433
N-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-2-imino-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide (PubChem CID 89121433) has the molecular formula C24H21F6N3O and a molecular weight of 481.44 g/mol. Its IUPAC name is N-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-2-imino-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide.
| Compound Name | N-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-2-imino-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 89121433 |
| Molecular Formula | C24H21F6N3O |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | N-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-2-imino-2-phenyl-N-[2-[4-(trifluoromethyl)phenyl]ethyl]acetamide |
| SMILES | [H]/N=C(/C(=O)N(CCc1ccc(C(F)(F)F)cc1)C(/C=C\C(=C)C(F)(F)F)=C/N)c1ccccc1 |
| InChI | InChI=1S/C24H21F6N3O/c1-16(23(25,26)27)7-12-20(15-31)33(22(34)21(32)18-5-3-2-4-6-18)14-13-17-8-10-19(11-9-17)24(28,29)30/h2-12,15,32H,1,13-14,31H2/b12-7-,20-15+,32-21+ |
| InChIKey | JRVISACKGWWUBS-OKPFPJKTSA-N |
| XLogP | 5.62 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|