C20H18N2O4S — CID 89123097
(E)-3-[3,5-dimethyl-4-[[5-(1,3-thiazol-4-ylmethoxy)-2-pyridinyl]oxy]phenyl]prop-2-enoic acid (PubChem CID 89123097) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is (E)-3-[3,5-dimethyl-4-[[5-(1,3-thiazol-4-ylmethoxy)-2-pyridinyl]oxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,5-dimethyl-4-[[5-(1,3-thiazol-4-ylmethoxy)-2-pyridinyl]oxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89123097 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (E)-3-[3,5-dimethyl-4-[[5-(1,3-thiazol-4-ylmethoxy)-2-pyridinyl]oxy]phenyl]prop-2-enoic acid |
| SMILES | Cc1cc(/C=C/C(=O)O)cc(C)c1Oc1ccc(OCc2cscn2)cn1 |
| InChI | InChI=1S/C20H18N2O4S/c1-13-7-15(3-6-19(23)24)8-14(2)20(13)26-18-5-4-17(9-21-18)25-10-16-11-27-12-22-16/h3-9,11-12H,10H2,1-2H3,(H,23,24)/b6-3+ |
| InChIKey | ZXELSYYJYCPRDZ-ZZXKWVIFSA-N |
| XLogP | 4.62 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|