C18H37NO2 — CID 89125113
(E,2S,3R)-2-amino-6-methylheptadec-4-ene-1,3-diol (PubChem CID 89125113) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is (E,2S,3R)-2-amino-6-methylheptadec-4-ene-1,3-diol.
| Compound Name | (E,2S,3R)-2-amino-6-methylheptadec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 89125113 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | (E,2S,3R)-2-amino-6-methylheptadec-4-ene-1,3-diol |
| SMILES | CCCCCCCCCCCC(C)/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C18H37NO2/c1-3-4-5-6-7-8-9-10-11-12-16(2)13-14-18(21)17(19)15-20/h13-14,16-18,20-21H,3-12,15,19H2,1-2H3/b14-13+/t16?,17-,18+/m0/s1 |
| InChIKey | KDQGNWUMAJEXSS-HLJNGVMWSA-N |
| XLogP | 3.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|