C20H28N4O5 — CID 89127586
tert-butyl 4-[[5-(3-amino-4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methoxy]piperidine-1-carboxylate (PubChem CID 89127586) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is tert-butyl 4-[[5-(3-amino-4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-(3-amino-4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89127586 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | tert-butyl 4-[[5-(3-amino-4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]methoxy]piperidine-1-carboxylate |
| SMILES | COc1ccc(-c2nc(COC3CCN(C(=O)OC(C)(C)C)CC3)no2)cc1N |
| InChI | InChI=1S/C20H28N4O5/c1-20(2,3)28-19(25)24-9-7-14(8-10-24)27-12-17-22-18(29-23-17)13-5-6-16(26-4)15(21)11-13/h5-6,11,14H,7-10,12,21H2,1-4H3 |
| InChIKey | PFVNCTBZFQRTGO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 112.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|