C19H26N4O4 — CID 89127589
tert-butyl 4-[[5-(4-aminophenyl)-1,2,4-oxadiazol-3-yl]methoxy]piperidine-1-carboxylate (PubChem CID 89127589) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is tert-butyl 4-[[5-(4-aminophenyl)-1,2,4-oxadiazol-3-yl]methoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-(4-aminophenyl)-1,2,4-oxadiazol-3-yl]methoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 89127589 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | tert-butyl 4-[[5-(4-aminophenyl)-1,2,4-oxadiazol-3-yl]methoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCc2noc(-c3ccc(N)cc3)n2)CC1 |
| InChI | InChI=1S/C19H26N4O4/c1-19(2,3)26-18(24)23-10-8-15(9-11-23)25-12-16-21-17(27-22-16)13-4-6-14(20)7-5-13/h4-7,15H,8-12,20H2,1-3H3 |
| InChIKey | YCRYJTMCZPXUAW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 103.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|