C22H26BrNO2 — CID 89131350
[(1S)-1-(4-bromophenyl)ethyl]-[(3S)-5-methyl-3-phenylhex-5-enyl]carbamic acid (PubChem CID 89131350) has the molecular formula C22H26BrNO2 and a molecular weight of 416.36 g/mol. Its IUPAC name is [(1S)-1-(4-bromophenyl)ethyl]-[(3S)-5-methyl-3-phenylhex-5-enyl]carbamic acid.
| Compound Name | [(1S)-1-(4-bromophenyl)ethyl]-[(3S)-5-methyl-3-phenylhex-5-enyl]carbamic acid |
|---|---|
| PubChem CID | 89131350 |
| Molecular Formula | C22H26BrNO2 |
| Molecular Weight | 416.36 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | [(1S)-1-(4-bromophenyl)ethyl]-[(3S)-5-methyl-3-phenylhex-5-enyl]carbamic acid |
| SMILES | C=C(C)C[C@@H](CCN(C(=O)O)[C@@H](C)c1ccc(Br)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H26BrNO2/c1-16(2)15-20(19-7-5-4-6-8-19)13-14-24(22(25)26)17(3)18-9-11-21(23)12-10-18/h4-12,17,20H,1,13-15H2,2-3H3,(H,25,26)/t17-,20+/m0/s1 |
| InChIKey | AADZFXZJVZTEDC-FXAWDEMLSA-N |
| XLogP | 6.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.36 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|