C21H23BFNO4 — CID 89134987
CID 89134987 (PubChem CID 89134987) has the molecular formula C21H23BFNO4 and a molecular weight of 383.23 g/mol.
| Compound Name | CID 89134987 |
|---|---|
| PubChem CID | 89134987 |
| Molecular Formula | C21H23BFNO4 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | — |
| SMILES | [B]c1ccc([C@H](C)N(CCC(CC(=O)OC)c2ccc(F)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C21H23BFNO4/c1-14(15-3-7-18(22)8-4-15)24(21(26)27)12-11-17(13-20(25)28-2)16-5-9-19(23)10-6-16/h3-10,14,17H,11-13H2,1-2H3,(H,26,27)/t14-,17?/m0/s1 |
| InChIKey | QJFNNLHNCPMUCP-MBIQTGHCSA-N |
| XLogP | 3.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|