About 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride
1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride (PubChem CID 89131430) has the molecular formula C22H25ClN4O2
and a molecular weight of 412.92 g/mol. Its IUPAC name is 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride.
Molecular Properties
| Compound Name | 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride |
| PubChem CID | 89131430 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride |
| SMILES | CC(C)(C)Nc1ncc(N2CCCC(C(=O)Cl)C2)cc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C22H25ClN4O2/c1-22(2,3)26-20-16(21-25-17-8-4-5-9-18(17)29-21)11-15(12-24-20)27-10-6-7-14(13-27)19(23)28/h4-5,8-9,11-12,14H,6-7,10,13H2,1-3H3,(H,24,26) |
| InChIKey | OPZNZDXLQXVYNT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride?
The IUPAC name of 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride (CID 89131430) is 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride.
What is the SMILES notation for 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride?
The canonical SMILES for 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride is CC(C)(C)Nc1ncc(N2CCCC(C(=O)Cl)C2)cc1-c1nc2ccccc2o1.
What is the InChIKey of 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride?
The InChIKey is OPZNZDXLQXVYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H25ClN4O2/c1-22(2,3)26-20-16(21-25-17-8-4-5-9-18(17)29-21)11-15(12-24-20)27-10-6-7-14(13-27)19(23)28/h4-5,8-9,11-12,14H,6-7,10,13H2,1-3H3,(H,24,26).
What are the key properties of 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride?
1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride has a molecular weight of 412.92 g/mol, XLogP of 5.08, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride is sourced from PubChem (CID 89131430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).