C22H25ClN4O2 — CID 89131430
1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride (PubChem CID 89131430) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride.
| Compound Name | 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 89131430 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[5-(1,3-benzoxazol-2-yl)-6-(tert-butylamino)-3-pyridinyl]piperidine-3-carbonyl chloride |
| SMILES | CC(C)(C)Nc1ncc(N2CCCC(C(=O)Cl)C2)cc1-c1nc2ccccc2o1 |
| InChI | InChI=1S/C22H25ClN4O2/c1-22(2,3)26-20-16(21-25-17-8-4-5-9-18(17)29-21)11-15(12-24-20)27-10-6-7-14(13-27)19(23)28/h4-5,8-9,11-12,14H,6-7,10,13H2,1-3H3,(H,24,26) |
| InChIKey | OPZNZDXLQXVYNT-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|