C16H24FN3O2 — CID 89133892
2-amino-N-(3-fluoropropyl)-5-(2-morpholin-4-ylethyl)benzamide (PubChem CID 89133892) has the molecular formula C16H24FN3O2 and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-amino-N-(3-fluoropropyl)-5-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 2-amino-N-(3-fluoropropyl)-5-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 89133892 |
| Molecular Formula | C16H24FN3O2 |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | 2-amino-N-(3-fluoropropyl)-5-(2-morpholin-4-ylethyl)benzamide |
| SMILES | Nc1ccc(CCN2CCOCC2)cc1C(=O)NCCCF |
| InChI | InChI=1S/C16H24FN3O2/c17-5-1-6-19-16(21)14-12-13(2-3-15(14)18)4-7-20-8-10-22-11-9-20/h2-3,12H,1,4-11,18H2,(H,19,21) |
| InChIKey | KOHOZULEXZDBTR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|