C24H24N4O4S2 — CID 89134874
[3-(6-amino-4-oxospiro[3H-thiochromene-2,4'-piperidine]-1'-carbonyl)-6-methoxy-1-benzothiophen-2-yl]urea (PubChem CID 89134874) has the molecular formula C24H24N4O4S2 and a molecular weight of 496.61 g/mol. Its IUPAC name is [3-(6-amino-4-oxospiro[3H-thiochromene-2,4'-piperidine]-1'-carbonyl)-6-methoxy-1-benzothiophen-2-yl]urea.
| Compound Name | [3-(6-amino-4-oxospiro[3H-thiochromene-2,4'-piperidine]-1'-carbonyl)-6-methoxy-1-benzothiophen-2-yl]urea |
|---|---|
| PubChem CID | 89134874 |
| Molecular Formula | C24H24N4O4S2 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | [3-(6-amino-4-oxospiro[3H-thiochromene-2,4'-piperidine]-1'-carbonyl)-6-methoxy-1-benzothiophen-2-yl]urea |
| SMILES | COc1ccc2c(C(=O)N3CCC4(CC3)CC(=O)c3cc(N)ccc3S4)c(NC(N)=O)sc2c1 |
| InChI | InChI=1S/C24H24N4O4S2/c1-32-14-3-4-15-19(11-14)33-21(27-23(26)31)20(15)22(30)28-8-6-24(7-9-28)12-17(29)16-10-13(25)2-5-18(16)34-24/h2-5,10-11H,6-9,12,25H2,1H3,(H3,26,27,31) |
| InChIKey | NGMVSAZOXIBZTN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 127.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|