C14H21N3O2 — CID 89135948
N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-nitrosobenzamide (PubChem CID 89135948) has the molecular formula C14H21N3O2 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-nitrosobenzamide.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-nitrosobenzamide |
|---|---|
| PubChem CID | 89135948 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-2-nitrosobenzamide |
| SMILES | CN(C)CC(C)(C)CNC(=O)c1ccccc1N=O |
| InChI | InChI=1S/C14H21N3O2/c1-14(2,10-17(3)4)9-15-13(18)11-7-5-6-8-12(11)16-19/h5-8H,9-10H2,1-4H3,(H,15,18) |
| InChIKey | KEJRBBMNGMWZGG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |