About 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine
5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine (PubChem CID 89138369) has the molecular formula C10H9FN2
and a molecular weight of 176.19 g/mol. Its IUPAC name is 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine.
Molecular Properties
| Compound Name | 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine |
| PubChem CID | 89138369 |
| Molecular Formula | C10H9FN2 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine |
| SMILES | FC1=CCCC=C1c1cncnc1 |
| InChI | InChI=1S/C10H9FN2/c11-10-4-2-1-3-9(10)8-5-12-7-13-6-8/h3-7H,1-2H2 |
| InChIKey | BUFDXLXPSVUQOF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine?
The IUPAC name of 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine (CID 89138369) is 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine.
What is the SMILES notation for 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine?
The canonical SMILES for 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine is FC1=CCCC=C1c1cncnc1.
What is the InChIKey of 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine?
The InChIKey is BUFDXLXPSVUQOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2/c11-10-4-2-1-3-9(10)8-5-12-7-13-6-8/h3-7H,1-2H2.
What are the key properties of 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine?
5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine has a molecular weight of 176.19 g/mol, XLogP of 2.51, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-fluorocyclohexa-1,5-dien-1-yl)pyrimidine is sourced from PubChem (CID 89138369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).