C64H54N2 — CID 89144306
1-[6-(2-cyclohexa-1,3-dien-1-yl-5-phenylpyrrol-1-yl)-9,10-bis(3,4,5-trimethylphenyl)anthracen-2-yl]-2,5-diphenylpyrrole (PubChem CID 89144306) has the molecular formula C64H54N2 and a molecular weight of 851.15 g/mol. Its IUPAC name is 1-[6-(2-cyclohexa-1,3-dien-1-yl-5-phenylpyrrol-1-yl)-9,10-bis(3,4,5-trimethylphenyl)anthracen-2-yl]-2,5-diphenylpyrrole.
| Compound Name | 1-[6-(2-cyclohexa-1,3-dien-1-yl-5-phenylpyrrol-1-yl)-9,10-bis(3,4,5-trimethylphenyl)anthracen-2-yl]-2,5-diphenylpyrrole |
|---|---|
| PubChem CID | 89144306 |
| Molecular Formula | C64H54N2 |
| Molecular Weight | 851.15 g/mol |
| Exact Mass | 850.43 |
| IUPAC Name | 1-[6-(2-cyclohexa-1,3-dien-1-yl-5-phenylpyrrol-1-yl)-9,10-bis(3,4,5-trimethylphenyl)anthracen-2-yl]-2,5-diphenylpyrrole |
| SMILES | Cc1cc(-c2c3ccc(-n4c(-c5ccccc5)ccc4-c4ccccc4)cc3c(-c3cc(C)c(C)c(C)c3)c3ccc(-n4c(C5=CC=CCC5)ccc4-c4ccccc4)cc23)cc(C)c1C |
| InChI | InChI=1S/C64H54N2/c1-41-35-51(36-42(2)45(41)5)63-55-29-27-54(66-61(49-23-15-9-16-24-49)33-34-62(66)50-25-17-10-18-26-50)40-58(55)64(52-37-43(3)46(6)44(4)38-52)56-30-28-53(39-57(56)63)65-59(47-19-11-7-12-20-47)31-32-60(65)48-21-13-8-14-22-48/h7-17,19-25,27-40H,18,26H2,1-6H3 |
| InChIKey | CHFATPMVBOLKKI-UHFFFAOYSA-N |
| XLogP | 17.49 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.15 |
| LogP ≤ 5 | 17.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|