C48H36S2 — CID 89360166
2-cyclohexa-1,3-dien-1-yl-5-[3-[2,6-dimethyl-10-[3-(5-phenylthiophen-2-yl)phenyl]anthracen-9-yl]phenyl]thiophene (PubChem CID 89360166) has the molecular formula C48H36S2 and a molecular weight of 676.95 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-5-[3-[2,6-dimethyl-10-[3-(5-phenylthiophen-2-yl)phenyl]anthracen-9-yl]phenyl]thiophene.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-5-[3-[2,6-dimethyl-10-[3-(5-phenylthiophen-2-yl)phenyl]anthracen-9-yl]phenyl]thiophene |
|---|---|
| PubChem CID | 89360166 |
| Molecular Formula | C48H36S2 |
| Molecular Weight | 676.95 g/mol |
| Exact Mass | 676.23 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-5-[3-[2,6-dimethyl-10-[3-(5-phenylthiophen-2-yl)phenyl]anthracen-9-yl]phenyl]thiophene |
| SMILES | Cc1ccc2c(-c3cccc(-c4ccc(-c5ccccc5)s4)c3)c3cc(C)ccc3c(-c3cccc(-c4ccc(C5=CC=CCC5)s4)c3)c2c1 |
| InChI | InChI=1S/C48H36S2/c1-31-19-21-39-41(27-31)47(37-17-9-15-35(29-37)45-25-23-43(49-45)33-11-5-3-6-12-33)40-22-20-32(2)28-42(40)48(39)38-18-10-16-36(30-38)46-26-24-44(50-46)34-13-7-4-8-14-34/h3-7,9-13,15-30H,8,14H2,1-2H3 |
| InChIKey | SYQSJUWOFUVFQY-UHFFFAOYSA-N |
| XLogP | 14.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.95 |
| LogP ≤ 5 | 14.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|