C40H31BO2 — CID 174020028
CID 174020028 (PubChem CID 174020028) has the molecular formula C40H31BO2 and a molecular weight of 554.50 g/mol.
| Compound Name | CID 174020028 |
|---|---|
| PubChem CID | 174020028 |
| Molecular Formula | C40H31BO2 |
| Molecular Weight | 554.50 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | — |
| SMILES | [B]c1c(O)c(C)c(C)c(-c2c3ccccc3c(-c3ccc(-c4ccccc4)cc3)c3ccc(C4=CC=CCC4)cc23)c1O |
| InChI | InChI=1S/C40H31BO2/c1-24-25(2)39(42)38(41)40(43)35(24)37-32-16-10-9-15-31(32)36(29-19-17-28(18-20-29)26-11-5-3-6-12-26)33-22-21-30(23-34(33)37)27-13-7-4-8-14-27/h3-7,9-13,15-23,42-43H,8,14H2,1-2H3 |
| InChIKey | BSTLEAQSMSXUOX-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.50 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|