C40H45Cl4NO9 — CID 89145135
[2,5-dichloro-9-(3,4-dichlorophenyl)-6-(2,2-dimethylpropanoyloxy)-9-formyloxy-7-[3-(6-hydroxyhexylamino)-3-oxopropyl]-4-methylxanthen-3-yl] 2,2-dimethylpropanoate (PubChem CID 89145135) has the molecular formula C40H45Cl4NO9 and a molecular weight of 825.61 g/mol. Its IUPAC name is [2,5-dichloro-9-(3,4-dichlorophenyl)-6-(2,2-dimethylpropanoyloxy)-9-formyloxy-7-[3-(6-hydroxyhexylamino)-3-oxopropyl]-4-methylxanthen-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [2,5-dichloro-9-(3,4-dichlorophenyl)-6-(2,2-dimethylpropanoyloxy)-9-formyloxy-7-[3-(6-hydroxyhexylamino)-3-oxopropyl]-4-methylxanthen-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 89145135 |
| Molecular Formula | C40H45Cl4NO9 |
| Molecular Weight | 825.61 g/mol |
| Exact Mass | 823.18 |
| IUPAC Name | [2,5-dichloro-9-(3,4-dichlorophenyl)-6-(2,2-dimethylpropanoyloxy)-9-formyloxy-7-[3-(6-hydroxyhexylamino)-3-oxopropyl]-4-methylxanthen-3-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1c(OC(=O)C(C)(C)C)c(Cl)cc2c1Oc1c(cc(CCC(=O)NCCCCCCO)c(OC(=O)C(C)(C)C)c1Cl)C2(OC=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C40H45Cl4NO9/c1-22-32-26(20-29(43)33(22)53-36(49)38(2,3)4)40(51-21-47,24-13-14-27(41)28(42)19-24)25-18-23(12-15-30(48)45-16-10-8-9-11-17-46)34(31(44)35(25)52-32)54-37(50)39(5,6)7/h13-14,18-21,46H,8-12,15-17H2,1-7H3,(H,45,48) |
| InChIKey | ZCXPKEJXNJCHTK-UHFFFAOYSA-N |
| XLogP | 9.68 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.61 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|