C30H25BrCl5NO7 — CID 59205791
3-(7'-bromo-4,4',5,6,7-pentachloro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl)-N-(6-methoxyhexyl)propanamide (PubChem CID 59205791) has the molecular formula C30H25BrCl5NO7 and a molecular weight of 768.70 g/mol. Its IUPAC name is 3-(7'-bromo-4,4',5,6,7-pentachloro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl)-N-(6-methoxyhexyl)propanamide.
| Compound Name | 3-(7'-bromo-4,4',5,6,7-pentachloro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl)-N-(6-methoxyhexyl)propanamide |
|---|---|
| PubChem CID | 59205791 |
| Molecular Formula | C30H25BrCl5NO7 |
| Molecular Weight | 768.70 g/mol |
| Exact Mass | 764.93 |
| IUPAC Name | 3-(7'-bromo-4,4',5,6,7-pentachloro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-2'-yl)-N-(6-methoxyhexyl)propanamide |
| SMILES | COCCCCCCNC(=O)CCc1cc2c(c(Cl)c1O)Oc1cc(O)c(Br)cc1C21OC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c21 |
| InChI | InChI=1S/C30H25BrCl5NO7/c1-42-9-5-3-2-4-8-37-19(39)7-6-13-10-15-28(26(36)27(13)40)43-18-12-17(38)16(31)11-14(18)30(15)21-20(29(41)44-30)22(32)24(34)25(35)23(21)33/h10-12,38,40H,2-9H2,1H3,(H,37,39) |
| InChIKey | XKHMTGJATQEIMM-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.70 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|