C21H6Cl6O7 — CID 54206211
1',2',4',5,6,7-hexachloro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxylic acid (PubChem CID 54206211) has the molecular formula C21H6Cl6O7 and a molecular weight of 582.99 g/mol. Its IUPAC name is 1',2',4',5,6,7-hexachloro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxylic acid.
| Compound Name | 1',2',4',5,6,7-hexachloro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxylic acid |
|---|---|
| PubChem CID | 54206211 |
| Molecular Formula | C21H6Cl6O7 |
| Molecular Weight | 582.99 g/mol |
| Exact Mass | 579.82 |
| IUPAC Name | 1',2',4',5,6,7-hexachloro-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-carboxylic acid |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(Cl)c2c1C(=O)OC21c2ccc(O)cc2Oc2c(Cl)c(O)c(Cl)c(Cl)c21 |
| InChI | InChI=1S/C21H6Cl6O7/c22-11-8(19(30)31)7-9(12(23)14(11)25)21(34-20(7)32)5-2-1-4(28)3-6(5)33-18-10(21)13(24)15(26)17(29)16(18)27/h1-3,28-29H,(H,30,31) |
| InChIKey | PSQRHZMWDJNZGS-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.99 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|