C22H14O6 — CID 67395441
7-acetyl-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 67395441) has the molecular formula C22H14O6 and a molecular weight of 374.35 g/mol. Its IUPAC name is 7-acetyl-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 7-acetyl-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 67395441 |
| Molecular Formula | C22H14O6 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 7-acetyl-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | CC(=O)c1cccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H14O6/c1-11(23)14-3-2-4-17-20(14)21(26)28-22(17)15-7-5-12(24)9-18(15)27-19-10-13(25)6-8-16(19)22/h2-10,24-25H,1H3 |
| InChIKey | ADVNJZJLJDWFKF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |