C24H17NO6 — CID 22098048
N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)-2-methylprop-2-enamide (PubChem CID 22098048) has the molecular formula C24H17NO6 and a molecular weight of 415.40 g/mol. Its IUPAC name is N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)-2-methylprop-2-enamide.
| Compound Name | N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 22098048 |
| Molecular Formula | C24H17NO6 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1cccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C24H17NO6/c1-12(2)22(28)25-18-5-3-4-17-21(18)23(29)31-24(17)15-8-6-13(26)10-19(15)30-20-11-14(27)7-9-16(20)24/h3-11,26-27H,1H2,2H3,(H,25,28) |
| InChIKey | VALUTEXQCVNQOH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|