C23H17NO5 — CID 68571230
7-(1-aminoprop-2-enyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 68571230) has the molecular formula C23H17NO5 and a molecular weight of 387.39 g/mol. Its IUPAC name is 7-(1-aminoprop-2-enyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 7-(1-aminoprop-2-enyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 68571230 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 7-(1-aminoprop-2-enyl)-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | C=CC(N)c1cccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C23H17NO5/c1-2-18(24)14-4-3-5-17-21(14)22(27)29-23(17)15-8-6-12(25)10-19(15)28-20-11-13(26)7-9-16(20)23/h2-11,18,25-26H,1,24H2 |
| InChIKey | YAABKPXZXRZYPE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|