About 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one
7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 23432586) has the molecular formula C20H11N3O5
and a molecular weight of 373.32 g/mol. Its IUPAC name is 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
Molecular Properties
| Compound Name | 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| PubChem CID | 23432586 |
| Molecular Formula | C20H11N3O5 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | [N-]=[N+]=Nc1cccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C20H11N3O5/c21-23-22-15-3-1-2-14-18(15)19(26)28-20(14)12-6-4-10(24)8-16(12)27-17-9-11(25)5-7-13(17)20/h1-9,24-25H |
| InChIKey | OJZZBMSTESSSJH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 124.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
The IUPAC name of 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one (CID 23432586) is 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one.
What is the SMILES notation for 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
The canonical SMILES for 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one is [N-]=[N+]=Nc1cccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21.
What is the InChIKey of 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
The InChIKey is OJZZBMSTESSSJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11N3O5/c21-23-22-15-3-1-2-14-18(15)19(26)28-20(14)12-6-4-10(24)8-16(12)27-17-9-11(25)5-7-13(17)20/h1-9,24-25H.
What are the key properties of 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one?
7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one has a molecular weight of 373.32 g/mol, XLogP of 4.61, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-azido-3',6'-dihydroxyspiro[2-benzofuran-3,9'-xanthene]-1-one is sourced from PubChem (CID 23432586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).