C22H14BrNO6 — CID 18408292
2-bromo-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)acetamide (PubChem CID 18408292) has the molecular formula C22H14BrNO6 and a molecular weight of 468.26 g/mol. Its IUPAC name is 2-bromo-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)acetamide.
| Compound Name | 2-bromo-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)acetamide |
|---|---|
| PubChem CID | 18408292 |
| Molecular Formula | C22H14BrNO6 |
| Molecular Weight | 468.26 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | 2-bromo-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)acetamide |
| SMILES | O=C(CBr)Nc1cccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H14BrNO6/c23-10-19(27)24-16-3-1-2-15-20(16)21(28)30-22(15)13-6-4-11(25)8-17(13)29-18-9-12(26)5-7-14(18)22/h1-9,25-26H,10H2,(H,24,27) |
| InChIKey | WAHFWYDKMCBCNV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|