C25H20N2O7S — CID 173289141
2-[(2R)-2-amino-3-oxopropyl]sulfanyl-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)acetamide (PubChem CID 173289141) has the molecular formula C25H20N2O7S and a molecular weight of 492.51 g/mol. Its IUPAC name is 2-[(2R)-2-amino-3-oxopropyl]sulfanyl-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)acetamide.
| Compound Name | 2-[(2R)-2-amino-3-oxopropyl]sulfanyl-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)acetamide |
|---|---|
| PubChem CID | 173289141 |
| Molecular Formula | C25H20N2O7S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 2-[(2R)-2-amino-3-oxopropyl]sulfanyl-N-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)acetamide |
| SMILES | N[C@H](C=O)CSCC(=O)Nc1cccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C25H20N2O7S/c26-13(10-28)11-35-12-22(31)27-19-3-1-2-18-23(19)24(32)34-25(18)16-6-4-14(29)8-20(16)33-21-9-15(30)5-7-17(21)25/h1-10,13,29-30H,11-12,26H2,(H,27,31)/t13-/m1/s1 |
| InChIKey | IYALNJYUXFPZHP-CYBMUJFWSA-N |
| XLogP | 2.86 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|