About methoxymethyl 3-(2-oxopropyl)benzoate
methoxymethyl 3-(2-oxopropyl)benzoate (PubChem CID 89146440) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is methoxymethyl 3-(2-oxopropyl)benzoate.
Molecular Properties
| Compound Name | methoxymethyl 3-(2-oxopropyl)benzoate |
| PubChem CID | 89146440 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | methoxymethyl 3-(2-oxopropyl)benzoate |
| SMILES | COCOC(=O)c1cccc(CC(C)=O)c1 |
| InChI | InChI=1S/C12H14O4/c1-9(13)6-10-4-3-5-11(7-10)12(14)16-8-15-2/h3-5,7H,6,8H2,1-2H3 |
| InChIKey | KOTXVTKFNBKMJY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methoxymethyl 3-(2-oxopropyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethyl 3-(2-oxopropyl)benzoate?
The IUPAC name of methoxymethyl 3-(2-oxopropyl)benzoate (CID 89146440) is methoxymethyl 3-(2-oxopropyl)benzoate.
What is the SMILES notation for methoxymethyl 3-(2-oxopropyl)benzoate?
The canonical SMILES for methoxymethyl 3-(2-oxopropyl)benzoate is COCOC(=O)c1cccc(CC(C)=O)c1.
What is the InChIKey of methoxymethyl 3-(2-oxopropyl)benzoate?
The InChIKey is KOTXVTKFNBKMJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-9(13)6-10-4-3-5-11(7-10)12(14)16-8-15-2/h3-5,7H,6,8H2,1-2H3.
What are the key properties of methoxymethyl 3-(2-oxopropyl)benzoate?
methoxymethyl 3-(2-oxopropyl)benzoate has a molecular weight of 222.24 g/mol, XLogP of 1.58, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethyl 3-(2-oxopropyl)benzoate is sourced from PubChem (CID 89146440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).