C5H5ClF6 — CID 89150301
2-Chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane (PubChem CID 89150301) has the molecular formula C5H5ClF6 and a molecular weight of 214.53 g/mol. Its IUPAC name is 2-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane.
| Compound Name | 2-Chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane |
|---|---|
| PubChem CID | 89150301 |
| Molecular Formula | C5H5ClF6 |
| Molecular Weight | 214.53 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 2-chloro-1,1,1-trifluoro-2-(trifluoromethyl)butane |
| SMILES | CCC(C(F)(F)F)(C(F)(F)F)Cl |
| InChI | InChI=1S/C5H5ClF6/c1-2-3(6,4(7,8)9)5(10,11)12/h2H2,1H3 |
| InChIKey | HATVYUGPIOGJJJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | 142 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|