C20H23N3O3S — CID 89153079
[2-[(2-carbamimidoyl-2,3-dihydro-1-benzothiophen-4-yl)oxy]-2-phenylethyl] N,N-dimethylcarbamate (PubChem CID 89153079) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is [2-[(2-carbamimidoyl-2,3-dihydro-1-benzothiophen-4-yl)oxy]-2-phenylethyl] N,N-dimethylcarbamate.
| Compound Name | [2-[(2-carbamimidoyl-2,3-dihydro-1-benzothiophen-4-yl)oxy]-2-phenylethyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 89153079 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | [2-[(2-carbamimidoyl-2,3-dihydro-1-benzothiophen-4-yl)oxy]-2-phenylethyl] N,N-dimethylcarbamate |
| SMILES | [H]/N=C(\N)C1Cc2c(OC(COC(=O)N(C)C)c3ccccc3)cccc2S1 |
| InChI | InChI=1S/C20H23N3O3S/c1-23(2)20(24)25-12-16(13-7-4-3-5-8-13)26-15-9-6-10-17-14(15)11-18(27-17)19(21)22/h3-10,16,18H,11-12H2,1-2H3,(H3,21,22) |
| InChIKey | ZGUGLOBVDQAFPG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|