C22H21N3O3S2 — CID 89153081
[2-[(2-carbamimidoyl-2,3-dihydro-1-benzothiophen-4-yl)oxy]-2-phenylethyl] N-thiophen-2-ylcarbamate (PubChem CID 89153081) has the molecular formula C22H21N3O3S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is [2-[(2-carbamimidoyl-2,3-dihydro-1-benzothiophen-4-yl)oxy]-2-phenylethyl] N-thiophen-2-ylcarbamate.
| Compound Name | [2-[(2-carbamimidoyl-2,3-dihydro-1-benzothiophen-4-yl)oxy]-2-phenylethyl] N-thiophen-2-ylcarbamate |
|---|---|
| PubChem CID | 89153081 |
| Molecular Formula | C22H21N3O3S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | [2-[(2-carbamimidoyl-2,3-dihydro-1-benzothiophen-4-yl)oxy]-2-phenylethyl] N-thiophen-2-ylcarbamate |
| SMILES | [H]/N=C(\N)C1Cc2c(OC(COC(=O)Nc3cccs3)c3ccccc3)cccc2S1 |
| InChI | InChI=1S/C22H21N3O3S2/c23-21(24)19-12-15-16(8-4-9-18(15)30-19)28-17(14-6-2-1-3-7-14)13-27-22(26)25-20-10-5-11-29-20/h1-11,17,19H,12-13H2,(H3,23,24)(H,25,26) |
| InChIKey | GUVHLNRHDNBJTB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|