C16H20N3O6+ — CID 89158341
2-[4-[4-[(5R)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-3-oxomorpholin-4-ium-4-yl]acetic acid (PubChem CID 89158341) has the molecular formula C16H20N3O6+ and a molecular weight of 350.35 g/mol. Its IUPAC name is 2-[4-[4-[(5R)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-3-oxomorpholin-4-ium-4-yl]acetic acid.
| Compound Name | 2-[4-[4-[(5R)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-3-oxomorpholin-4-ium-4-yl]acetic acid |
|---|---|
| PubChem CID | 89158341 |
| Molecular Formula | C16H20N3O6+ |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-[4-[4-[(5R)-5-(aminomethyl)-2-oxo-1,3-oxazolidin-3-yl]phenyl]-3-oxomorpholin-4-ium-4-yl]acetic acid |
| SMILES | NC[C@@H]1CN(c2ccc([N+]3(CC(=O)O)CCOCC3=O)cc2)C(=O)O1 |
| InChI | InChI=1S/C16H19N3O6/c17-7-13-8-18(16(23)25-13)11-1-3-12(4-2-11)19(9-15(21)22)5-6-24-10-14(19)20/h1-4,13H,5-10,17H2/p+1/t13-,19?/m1/s1 |
| InChIKey | DLYJWXVAJZTRBC-BSOCMFCZSA-O |
| XLogP | -0.08 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|