C26H54NOS+ — CID 89159632
3-(9,10-dimethyloctadecanoylsulfanyl)propyl-trimethylazanium (PubChem CID 89159632) has the molecular formula C26H54NOS+ and a molecular weight of 428.79 g/mol. Its IUPAC name is 3-(9,10-dimethyloctadecanoylsulfanyl)propyl-trimethylazanium.
| Compound Name | 3-(9,10-dimethyloctadecanoylsulfanyl)propyl-trimethylazanium |
|---|---|
| PubChem CID | 89159632 |
| Molecular Formula | C26H54NOS+ |
| Molecular Weight | 428.79 g/mol |
| Exact Mass | 428.39 |
| IUPAC Name | 3-(9,10-dimethyloctadecanoylsulfanyl)propyl-trimethylazanium |
| SMILES | CCCCCCCCC(C)C(C)CCCCCCCC(=O)SCCC[N+](C)(C)C |
| InChI | InChI=1S/C26H54NOS/c1-7-8-9-10-12-15-19-24(2)25(3)20-16-13-11-14-17-21-26(28)29-23-18-22-27(4,5)6/h24-25H,7-23H2,1-6H3/q+1 |
| InChIKey | NAZUEBPLDPMDRH-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.79 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|