C23H22FN3O3S — CID 89161448
2-[[2-[6-(4-fluoroanilino)-3-pyridinyl]-5-methoxy-3-methyl-1-benzofuran-6-yl]-sulfanylamino]ethanol (PubChem CID 89161448) has the molecular formula C23H22FN3O3S and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[[2-[6-(4-fluoroanilino)-3-pyridinyl]-5-methoxy-3-methyl-1-benzofuran-6-yl]-sulfanylamino]ethanol.
| Compound Name | 2-[[2-[6-(4-fluoroanilino)-3-pyridinyl]-5-methoxy-3-methyl-1-benzofuran-6-yl]-sulfanylamino]ethanol |
|---|---|
| PubChem CID | 89161448 |
| Molecular Formula | C23H22FN3O3S |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-[[2-[6-(4-fluoroanilino)-3-pyridinyl]-5-methoxy-3-methyl-1-benzofuran-6-yl]-sulfanylamino]ethanol |
| SMILES | COc1cc2c(C)c(-c3ccc(Nc4ccc(F)cc4)nc3)oc2cc1N(S)CCO |
| InChI | InChI=1S/C23H22FN3O3S/c1-14-18-11-21(29-2)19(27(31)9-10-28)12-20(18)30-23(14)15-3-8-22(25-13-15)26-17-6-4-16(24)5-7-17/h3-8,11-13,28,31H,9-10H2,1-2H3,(H,25,26) |
| InChIKey | ABVUPNQAGOPPGI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|