C19H25ClN3O3S+ — CID 8916153
[(1R)-1-(2-chlorophenyl)-2-[[3-(dimethylsulfamoyl)benzoyl]amino]ethyl]-dimethylazanium (PubChem CID 8916153) has the molecular formula C19H25ClN3O3S+ and a molecular weight of 410.95 g/mol. Its IUPAC name is [(1R)-1-(2-chlorophenyl)-2-[[3-(dimethylsulfamoyl)benzoyl]amino]ethyl]-dimethylazanium.
| Compound Name | [(1R)-1-(2-chlorophenyl)-2-[[3-(dimethylsulfamoyl)benzoyl]amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8916153 |
| Molecular Formula | C19H25ClN3O3S+ |
| Molecular Weight | 410.95 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [(1R)-1-(2-chlorophenyl)-2-[[3-(dimethylsulfamoyl)benzoyl]amino]ethyl]-dimethylazanium |
| SMILES | CN(C)S(=O)(=O)c1cccc(C(=O)NC[C@@H](c2ccccc2Cl)[NH+](C)C)c1 |
| InChI | InChI=1S/C19H24ClN3O3S/c1-22(2)18(16-10-5-6-11-17(16)20)13-21-19(24)14-8-7-9-15(12-14)27(25,26)23(3)4/h5-12,18H,13H2,1-4H3,(H,21,24)/p+1/t18-/m0/s1 |
| InChIKey | NSXCKRUVGGGYSA-SFHVURJKSA-O |
| XLogP | 1.21 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.95 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |