About 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde
9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde (PubChem CID 89166054) has the molecular formula C30H21N3O
and a molecular weight of 439.52 g/mol. Its IUPAC name is 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde |
| PubChem CID | 89166054 |
| Molecular Formula | C30H21N3O |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)c1ccccc1n2-c1cccc(-n2c3c(c4ccccc42)C=CCC3)n1 |
| InChI | InChI=1S/C30H21N3O/c34-19-20-16-17-28-24(18-20)23-10-3-6-13-27(23)33(28)30-15-7-14-29(31-30)32-25-11-4-1-8-21(25)22-9-2-5-12-26(22)32/h1-4,6-11,13-19H,5,12H2 |
| InChIKey | IXLBGBACXAPRAE-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde?
The IUPAC name of 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde (CID 89166054) is 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde.
What is the SMILES notation for 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde?
The canonical SMILES for 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde is O=Cc1ccc2c(c1)c1ccccc1n2-c1cccc(-n2c3c(c4ccccc42)C=CCC3)n1.
What is the InChIKey of 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde?
The InChIKey is IXLBGBACXAPRAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H21N3O/c34-19-20-16-17-28-24(18-20)23-10-3-6-13-27(23)33(28)30-15-7-14-29(31-30)32-25-11-4-1-8-21(25)22-9-2-5-12-26(22)32/h1-4,6-11,13-19H,5,12H2.
What are the key properties of 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde?
9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde has a molecular weight of 439.52 g/mol, XLogP of 6.89, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[6-(1,2-dihydrocarbazol-9-yl)-2-pyridinyl]carbazole-3-carbaldehyde is sourced from PubChem (CID 89166054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).