C24H25BrO4 — CID 89166490
tert-butyl 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]prop-2-enoate (PubChem CID 89166490) has the molecular formula C24H25BrO4 and a molecular weight of 457.36 g/mol. Its IUPAC name is tert-butyl 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]prop-2-enoate.
| Compound Name | tert-butyl 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]prop-2-enoate |
|---|---|
| PubChem CID | 89166490 |
| Molecular Formula | C24H25BrO4 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.09 |
| IUPAC Name | tert-butyl 2-[4-[(E)-3-(4-bromophenyl)-3-oxoprop-1-enyl]-2,6-dimethylphenoxy]prop-2-enoate |
| SMILES | C=C(Oc1c(C)cc(/C=C/C(=O)c2ccc(Br)cc2)cc1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H25BrO4/c1-15-13-18(7-12-21(26)19-8-10-20(25)11-9-19)14-16(2)22(15)28-17(3)23(27)29-24(4,5)6/h7-14H,3H2,1-2,4-6H3/b12-7+ |
| InChIKey | XCVXDUVFRUACRT-KPKJPENVSA-N |
| XLogP | 6.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|