C19H21ClN4O3S — CID 8917124
4-chloro-3-(diethylsulfamoyl)-N-(imidazo[1,2-a]pyridin-2-ylmethyl)benzamide (PubChem CID 8917124) has the molecular formula C19H21ClN4O3S and a molecular weight of 420.92 g/mol. Its IUPAC name is 4-chloro-3-(diethylsulfamoyl)-N-(imidazo[1,2-a]pyridin-2-ylmethyl)benzamide.
| Compound Name | 4-chloro-3-(diethylsulfamoyl)-N-(imidazo[1,2-a]pyridin-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 8917124 |
| Molecular Formula | C19H21ClN4O3S |
| Molecular Weight | 420.92 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 4-chloro-3-(diethylsulfamoyl)-N-(imidazo[1,2-a]pyridin-2-ylmethyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(C(=O)NCc2cn3ccccc3n2)ccc1Cl |
| InChI | InChI=1S/C19H21ClN4O3S/c1-3-24(4-2)28(26,27)17-11-14(8-9-16(17)20)19(25)21-12-15-13-23-10-6-5-7-18(23)22-15/h5-11,13H,3-4,12H2,1-2H3,(H,21,25) |
| InChIKey | AEKFDAMPKAWBDW-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.92 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |