C20H22N4O2 — CID 89171413
2-propan-2-yloxy-5-[3-(1,2,3,4-tetrahydroisoquinolin-5-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 89171413) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-propan-2-yloxy-5-[3-(1,2,3,4-tetrahydroisoquinolin-5-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2-propan-2-yloxy-5-[3-(1,2,3,4-tetrahydroisoquinolin-5-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 89171413 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 2-propan-2-yloxy-5-[3-(1,2,3,4-tetrahydroisoquinolin-5-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c3CCNC4)no2)cc1N |
| InChI | InChI=1S/C20H22N4O2/c1-12(2)25-18-7-6-13(10-17(18)21)20-23-19(24-26-20)16-5-3-4-14-11-22-9-8-15(14)16/h3-7,10,12,22H,8-9,11,21H2,1-2H3 |
| InChIKey | GHPLHWZNNLNSNW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|