C13H8F3NO2S — CID 89172621
2,4,5-trifluoro-N-(2-formyl-4-methylthiophen-3-yl)benzamide (PubChem CID 89172621) has the molecular formula C13H8F3NO2S and a molecular weight of 299.27 g/mol. Its IUPAC name is 2,4,5-trifluoro-N-(2-formyl-4-methylthiophen-3-yl)benzamide.
| Compound Name | 2,4,5-trifluoro-N-(2-formyl-4-methylthiophen-3-yl)benzamide |
|---|---|
| PubChem CID | 89172621 |
| Molecular Formula | C13H8F3NO2S |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 2,4,5-trifluoro-N-(2-formyl-4-methylthiophen-3-yl)benzamide |
| SMILES | Cc1csc(C=O)c1NC(=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C13H8F3NO2S/c1-6-5-20-11(4-18)12(6)17-13(19)7-2-9(15)10(16)3-8(7)14/h2-5H,1H3,(H,17,19) |
| InChIKey | WOSHZZMRBBCWJV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|