C17H30ClN3O3S — CID 89174014
(2S)-2-[(5-chloro-1-methylpiperidin-3-yl)oxymethyl]-N-(oxolan-2-ylmethyl)morpholine-4-carbothioamide (PubChem CID 89174014) has the molecular formula C17H30ClN3O3S and a molecular weight of 391.97 g/mol. Its IUPAC name is (2S)-2-[(5-chloro-1-methylpiperidin-3-yl)oxymethyl]-N-(oxolan-2-ylmethyl)morpholine-4-carbothioamide.
| Compound Name | (2S)-2-[(5-chloro-1-methylpiperidin-3-yl)oxymethyl]-N-(oxolan-2-ylmethyl)morpholine-4-carbothioamide |
|---|---|
| PubChem CID | 89174014 |
| Molecular Formula | C17H30ClN3O3S |
| Molecular Weight | 391.97 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | (2S)-2-[(5-chloro-1-methylpiperidin-3-yl)oxymethyl]-N-(oxolan-2-ylmethyl)morpholine-4-carbothioamide |
| SMILES | CN1CC(Cl)CC(OC[C@@H]2CN(C(=S)NCC3CCCO3)CCO2)C1 |
| InChI | InChI=1S/C17H30ClN3O3S/c1-20-9-13(18)7-15(10-20)24-12-16-11-21(4-6-23-16)17(25)19-8-14-3-2-5-22-14/h13-16H,2-12H2,1H3,(H,19,25)/t13?,14?,15?,16-/m0/s1 |
| InChIKey | AGBZVOJDSDIFMO-AUSYRVNMSA-N |
| XLogP | 1.07 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.97 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|