C17H27NO — CID 89174574
N-[[(1R,2S)-2-[(Z)-hex-3-enyl]cyclopropyl]methyl]-N-prop-2-enylcyclopropanecarboxamide (PubChem CID 89174574) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is N-[[(1R,2S)-2-[(Z)-hex-3-enyl]cyclopropyl]methyl]-N-prop-2-enylcyclopropanecarboxamide.
| Compound Name | N-[[(1R,2S)-2-[(Z)-hex-3-enyl]cyclopropyl]methyl]-N-prop-2-enylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 89174574 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | N-[[(1R,2S)-2-[(Z)-hex-3-enyl]cyclopropyl]methyl]-N-prop-2-enylcyclopropanecarboxamide |
| SMILES | C=CCN(C[C@@H]1C[C@@H]1CC/C=C\CC)C(=O)C1CC1 |
| InChI | InChI=1S/C17H27NO/c1-3-5-6-7-8-15-12-16(15)13-18(11-4-2)17(19)14-9-10-14/h4-6,14-16H,2-3,7-13H2,1H3/b6-5-/t15-,16-/m0/s1 |
| InChIKey | IDOJXJXIQURGOJ-XFCCUVRLSA-N |
| XLogP | 3.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|