C18H29NO — CID 70997462
N-(cyclopropylmethyl)-N-[[(1R,2S)-2-[(Z)-hex-3-enyl]cyclopropyl]methyl]cyclopropanecarboxamide (PubChem CID 70997462) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-N-[[(1R,2S)-2-[(Z)-hex-3-enyl]cyclopropyl]methyl]cyclopropanecarboxamide.
| Compound Name | N-(cyclopropylmethyl)-N-[[(1R,2S)-2-[(Z)-hex-3-enyl]cyclopropyl]methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 70997462 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | N-(cyclopropylmethyl)-N-[[(1R,2S)-2-[(Z)-hex-3-enyl]cyclopropyl]methyl]cyclopropanecarboxamide |
| SMILES | CC/C=C\CC[C@H]1C[C@H]1CN(CC1CC1)C(=O)C1CC1 |
| InChI | InChI=1S/C18H29NO/c1-2-3-4-5-6-16-11-17(16)13-19(12-14-7-8-14)18(20)15-9-10-15/h3-4,14-17H,2,5-13H2,1H3/b4-3-/t16-,17-/m0/s1 |
| InChIKey | FGQPJCYOJMGADH-QCDWVSHVSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|